Parim urolitiin B pulber (1139-83-9) Tootja ja tehas

Urolitiin B pulber

November 9, 2020

Urolithin BSpecifications

Nimi: Urolitiin B
Keemiline nimetus: 3-hüdroksü-6H-dibenso [b, d] püraan-6-oon
CAS: 1139-83-9
Keemiline valem: C13H8O3
Molekulmass: 212.2 g / mol
Värvus:  Valge pulber
InChi-võti: WXUQMTRHPNOXBV-UHFFFAOYSA-N
SMILES kood: O=C1C2=CC=CC=C2C3=CC=C(O)C=C3O1
Ametikoht: Urolitiin B võib parandada mitokondrite ja lihaste talitlust.

Urolitiin B võib vananemise ajal parandada lihasjõudu ja vastupidavust.

Rakendus: Urolitiin B on ellagitanni soolestiku mikroobne metaboliit ja sellel on tugev antioksüdant ja prooksüdant, sõltuvalt analüüsisüsteemist ja tingimustest. Urolitiin B võib samuti avaldada östrogeenset ja / või antiöstrogeenset toimet.
Lahustuvus: Lahustub kergesti N, N-dimetüülformamiidis ja dimetüülmetüleenis. Sulfoon, metanoolis, etanoolis ja etüülatsetaadis lahustuv
Hoidmise temp: Hügroskoopne, -20 ° C sügavkülmik, inertses atmosfääris
Saatmistingimused: Saadetud ümbritseva õhu temperatuurina kui mitteohtlik kemikaal. See toode on tavapostiga ja tollis veedetud aja jooksul mõne nädala jooksul stabiilne.